C12H15ClFN3O — CID 66078137
5-chloro-1-(1-ethoxypropan-2-yl)-6-fluorobenzimidazol-2-amine (PubChem CID 66078137) has the molecular formula C12H15ClFN3O and a molecular weight of 271.72 g/mol. Its IUPAC name is 5-chloro-1-(1-ethoxypropan-2-yl)-6-fluorobenzimidazol-2-amine.
| Compound Name | 5-chloro-1-(1-ethoxypropan-2-yl)-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66078137 |
| Molecular Formula | C12H15ClFN3O |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 5-chloro-1-(1-ethoxypropan-2-yl)-6-fluorobenzimidazol-2-amine |
| SMILES | CCOCC(C)n1c(N)nc2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C12H15ClFN3O/c1-3-18-6-7(2)17-11-5-9(14)8(13)4-10(11)16-12(17)15/h4-5,7H,3,6H2,1-2H3,(H2,15,16) |
| InChIKey | BLBLKYBNBCYOIC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |