C14H18Cl2N2O — CID 115471350
6-chloro-2-(2-chloroethyl)-1-(1-ethoxypropan-2-yl)benzimidazole (PubChem CID 115471350) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 6-chloro-2-(2-chloroethyl)-1-(1-ethoxypropan-2-yl)benzimidazole.
| Compound Name | 6-chloro-2-(2-chloroethyl)-1-(1-ethoxypropan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 115471350 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 6-chloro-2-(2-chloroethyl)-1-(1-ethoxypropan-2-yl)benzimidazole |
| SMILES | CCOCC(C)n1c(CCCl)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-3-19-9-10(2)18-13-8-11(16)4-5-12(13)17-14(18)6-7-15/h4-5,8,10H,3,6-7,9H2,1-2H3 |
| InChIKey | WRUOVHOFVVOGTG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|