C16H23BrClN3 — CID 65346330
2-[6-bromo-2-(2-chloroethyl)benzimidazol-1-yl]-N,N-diethylpropan-1-amine (PubChem CID 65346330) has the molecular formula C16H23BrClN3 and a molecular weight of 372.74 g/mol. Its IUPAC name is 2-[6-bromo-2-(2-chloroethyl)benzimidazol-1-yl]-N,N-diethylpropan-1-amine.
| Compound Name | 2-[6-bromo-2-(2-chloroethyl)benzimidazol-1-yl]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 65346330 |
| Molecular Formula | C16H23BrClN3 |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-[6-bromo-2-(2-chloroethyl)benzimidazol-1-yl]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CC(C)n1c(CCCl)nc2ccc(Br)cc21 |
| InChI | InChI=1S/C16H23BrClN3/c1-4-20(5-2)11-12(3)21-15-10-13(17)6-7-14(15)19-16(21)8-9-18/h6-7,10,12H,4-5,8-9,11H2,1-3H3 |
| InChIKey | QOGQDILLUXSNSO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|