C14H18BrClN2 — CID 65344548
6-bromo-2-(2-chloroethyl)-1-(2-methylbutan-2-yl)benzimidazole (PubChem CID 65344548) has the molecular formula C14H18BrClN2 and a molecular weight of 329.67 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-1-(2-methylbutan-2-yl)benzimidazole.
| Compound Name | 6-bromo-2-(2-chloroethyl)-1-(2-methylbutan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 65344548 |
| Molecular Formula | C14H18BrClN2 |
| Molecular Weight | 329.67 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-1-(2-methylbutan-2-yl)benzimidazole |
| SMILES | CCC(C)(C)n1c(CCCl)nc2ccc(Br)cc21 |
| InChI | InChI=1S/C14H18BrClN2/c1-4-14(2,3)18-12-9-10(15)5-6-11(12)17-13(18)7-8-16/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | RIBWIVCNDIEOOY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|