C15H20BrClN2O — CID 114943389
6-bromo-2-(2-chloroethyl)-1-(2-ethoxy-2-methylpropyl)benzimidazole (PubChem CID 114943389) has the molecular formula C15H20BrClN2O and a molecular weight of 359.70 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-1-(2-ethoxy-2-methylpropyl)benzimidazole.
| Compound Name | 6-bromo-2-(2-chloroethyl)-1-(2-ethoxy-2-methylpropyl)benzimidazole |
|---|---|
| PubChem CID | 114943389 |
| Molecular Formula | C15H20BrClN2O |
| Molecular Weight | 359.70 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-1-(2-ethoxy-2-methylpropyl)benzimidazole |
| SMILES | CCOC(C)(C)Cn1c(CCCl)nc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H20BrClN2O/c1-4-20-15(2,3)10-19-13-9-11(16)5-6-12(13)18-14(19)7-8-17/h5-6,9H,4,7-8,10H2,1-3H3 |
| InChIKey | RUDDDQUWSDEXFR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|