C15H19BrClFN2O — CID 114943358
6-bromo-2-(2-chloroethyl)-1-(2-ethoxy-2-methylpropyl)-5-fluorobenzimidazole (PubChem CID 114943358) has the molecular formula C15H19BrClFN2O and a molecular weight of 377.69 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-1-(2-ethoxy-2-methylpropyl)-5-fluorobenzimidazole.
| Compound Name | 6-bromo-2-(2-chloroethyl)-1-(2-ethoxy-2-methylpropyl)-5-fluorobenzimidazole |
|---|---|
| PubChem CID | 114943358 |
| Molecular Formula | C15H19BrClFN2O |
| Molecular Weight | 377.69 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-1-(2-ethoxy-2-methylpropyl)-5-fluorobenzimidazole |
| SMILES | CCOC(C)(C)Cn1c(CCCl)nc2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C15H19BrClFN2O/c1-4-21-15(2,3)9-20-13-7-10(16)11(18)8-12(13)19-14(20)5-6-17/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | IJPYYPZJNJTYTM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.69 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|