C14H13BrFN3S — CID 66087858
5-bromo-6-fluoro-1-[1-(5-methylthiophen-2-yl)ethyl]benzimidazol-2-amine (PubChem CID 66087858) has the molecular formula C14H13BrFN3S and a molecular weight of 354.25 g/mol. Its IUPAC name is 5-bromo-6-fluoro-1-[1-(5-methylthiophen-2-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 5-bromo-6-fluoro-1-[1-(5-methylthiophen-2-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 66087858 |
| Molecular Formula | C14H13BrFN3S |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 5-bromo-6-fluoro-1-[1-(5-methylthiophen-2-yl)ethyl]benzimidazol-2-amine |
| SMILES | Cc1ccc(C(C)n2c(N)nc3cc(Br)c(F)cc32)s1 |
| InChI | InChI=1S/C14H13BrFN3S/c1-7-3-4-13(20-7)8(2)19-12-6-10(16)9(15)5-11(12)18-14(19)17/h3-6,8H,1-2H3,(H2,17,18) |
| InChIKey | SDPBPCATBLTCNQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |