C14H10Br2FN3O — CID 107601345
1-(2,6-dibromophenyl)-5-fluoro-6-methoxybenzimidazol-2-amine (PubChem CID 107601345) has the molecular formula C14H10Br2FN3O and a molecular weight of 415.06 g/mol. Its IUPAC name is 1-(2,6-dibromophenyl)-5-fluoro-6-methoxybenzimidazol-2-amine.
| Compound Name | 1-(2,6-dibromophenyl)-5-fluoro-6-methoxybenzimidazol-2-amine |
|---|---|
| PubChem CID | 107601345 |
| Molecular Formula | C14H10Br2FN3O |
| Molecular Weight | 415.06 g/mol |
| Exact Mass | 412.92 |
| IUPAC Name | 1-(2,6-dibromophenyl)-5-fluoro-6-methoxybenzimidazol-2-amine |
| SMILES | COc1cc2c(cc1F)nc(N)n2-c1c(Br)cccc1Br |
| InChI | InChI=1S/C14H10Br2FN3O/c1-21-12-6-11-10(5-9(12)17)19-14(18)20(11)13-7(15)3-2-4-8(13)16/h2-6H,1H3,(H2,18,19) |
| InChIKey | RHLWKNLCHZHMKU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.06 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |