C15H14FN3O2 — CID 83003060
1-(2-fluorophenyl)-5,6-dimethoxybenzimidazol-2-amine (PubChem CID 83003060) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5,6-dimethoxybenzimidazol-2-amine.
| Compound Name | 1-(2-fluorophenyl)-5,6-dimethoxybenzimidazol-2-amine |
|---|---|
| PubChem CID | 83003060 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-(2-fluorophenyl)-5,6-dimethoxybenzimidazol-2-amine |
| SMILES | COc1cc2nc(N)n(-c3ccccc3F)c2cc1OC |
| InChI | InChI=1S/C15H14FN3O2/c1-20-13-7-10-12(8-14(13)21-2)19(15(17)18-10)11-6-4-3-5-9(11)16/h3-8H,1-2H3,(H2,17,18) |
| InChIKey | OLGOGSOPCALOSZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |