C15H15N3O2 — CID 83008746
5,6-dimethoxy-1-phenylbenzimidazol-2-amine (PubChem CID 83008746) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5,6-dimethoxy-1-phenylbenzimidazol-2-amine.
| Compound Name | 5,6-dimethoxy-1-phenylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 83008746 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5,6-dimethoxy-1-phenylbenzimidazol-2-amine |
| SMILES | COc1cc2nc(N)n(-c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C15H15N3O2/c1-19-13-8-11-12(9-14(13)20-2)18(15(16)17-11)10-6-4-3-5-7-10/h3-9H,1-2H3,(H2,16,17) |
| InChIKey | XYNBPZCMXVERIC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |