C10H10BrFN2OS — CID 66088395
6-bromo-5-fluoro-3-(2-methoxyethyl)-1H-benzimidazole-2-thione (PubChem CID 66088395) has the molecular formula C10H10BrFN2OS and a molecular weight of 305.17 g/mol. Its IUPAC name is 6-bromo-5-fluoro-3-(2-methoxyethyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-5-fluoro-3-(2-methoxyethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66088395 |
| Molecular Formula | C10H10BrFN2OS |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 6-bromo-5-fluoro-3-(2-methoxyethyl)-1H-benzimidazole-2-thione |
| SMILES | COCCn1c(=S)[nH]c2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C10H10BrFN2OS/c1-15-3-2-14-9-5-7(12)6(11)4-8(9)13-10(14)16/h4-5H,2-3H2,1H3,(H,13,16) |
| InChIKey | OBBQEDPZHZCMOR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|