C10H10F2N2OS — CID 62532191
4,5-difluoro-3-(2-methoxyethyl)-1H-benzimidazole-2-thione (PubChem CID 62532191) has the molecular formula C10H10F2N2OS and a molecular weight of 244.27 g/mol. Its IUPAC name is 4,5-difluoro-3-(2-methoxyethyl)-1H-benzimidazole-2-thione.
| Compound Name | 4,5-difluoro-3-(2-methoxyethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 62532191 |
| Molecular Formula | C10H10F2N2OS |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4,5-difluoro-3-(2-methoxyethyl)-1H-benzimidazole-2-thione |
| SMILES | COCCn1c(=S)[nH]c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C10H10F2N2OS/c1-15-5-4-14-9-7(13-10(14)16)3-2-6(11)8(9)12/h2-3H,4-5H2,1H3,(H,13,16) |
| InChIKey | PEPIHWJSTHZSSB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|