C12H14F2N2S — CID 55085934
4,5-difluoro-3-(2-methylbutan-2-yl)-1H-benzimidazole-2-thione (PubChem CID 55085934) has the molecular formula C12H14F2N2S and a molecular weight of 256.32 g/mol. Its IUPAC name is 4,5-difluoro-3-(2-methylbutan-2-yl)-1H-benzimidazole-2-thione.
| Compound Name | 4,5-difluoro-3-(2-methylbutan-2-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 55085934 |
| Molecular Formula | C12H14F2N2S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4,5-difluoro-3-(2-methylbutan-2-yl)-1H-benzimidazole-2-thione |
| SMILES | CCC(C)(C)n1c(=S)[nH]c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C12H14F2N2S/c1-4-12(2,3)16-10-8(15-11(16)17)6-5-7(13)9(10)14/h5-6H,4H2,1-3H3,(H,15,17) |
| InChIKey | IMGZVKOUCJPYFA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|