C12H12F2N2S — CID 114155408
4,5-difluoro-3-(3-methylbut-2-enyl)-1H-benzimidazole-2-thione (PubChem CID 114155408) has the molecular formula C12H12F2N2S and a molecular weight of 254.30 g/mol. Its IUPAC name is 4,5-difluoro-3-(3-methylbut-2-enyl)-1H-benzimidazole-2-thione.
| Compound Name | 4,5-difluoro-3-(3-methylbut-2-enyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114155408 |
| Molecular Formula | C12H12F2N2S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 4,5-difluoro-3-(3-methylbut-2-enyl)-1H-benzimidazole-2-thione |
| SMILES | CC(C)=CCn1c(=S)[nH]c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C12H12F2N2S/c1-7(2)5-6-16-11-9(15-12(16)17)4-3-8(13)10(11)14/h3-5H,6H2,1-2H3,(H,15,17) |
| InChIKey | ZOLALNDXTLJCOZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|