C13H14F2N2OS — CID 106405784
3-(2-but-3-enoxyethyl)-4,5-difluoro-1H-benzimidazole-2-thione (PubChem CID 106405784) has the molecular formula C13H14F2N2OS and a molecular weight of 284.33 g/mol. Its IUPAC name is 3-(2-but-3-enoxyethyl)-4,5-difluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-(2-but-3-enoxyethyl)-4,5-difluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106405784 |
| Molecular Formula | C13H14F2N2OS |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(2-but-3-enoxyethyl)-4,5-difluoro-1H-benzimidazole-2-thione |
| SMILES | C=CCCOCCn1c(=S)[nH]c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C13H14F2N2OS/c1-2-3-7-18-8-6-17-12-10(16-13(17)19)5-4-9(14)11(12)15/h2,4-5H,1,3,6-8H2,(H,16,19) |
| InChIKey | KAXULOPZBPCPBS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|