C14H18N2O2S — CID 106405729
3-(2-but-3-enoxyethyl)-7-methoxy-1H-benzimidazole-2-thione (PubChem CID 106405729) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-(2-but-3-enoxyethyl)-7-methoxy-1H-benzimidazole-2-thione.
| Compound Name | 3-(2-but-3-enoxyethyl)-7-methoxy-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106405729 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(2-but-3-enoxyethyl)-7-methoxy-1H-benzimidazole-2-thione |
| SMILES | C=CCCOCCn1c(=S)[nH]c2c(OC)cccc21 |
| InChI | InChI=1S/C14H18N2O2S/c1-3-4-9-18-10-8-16-11-6-5-7-12(17-2)13(11)15-14(16)19/h3,5-7H,1,4,8-10H2,2H3,(H,15,19) |
| InChIKey | ODKGFIIXWGGTPH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|