C12H11N3O2S — CID 106419496
7-methoxy-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 106419496) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 7-methoxy-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 7-methoxy-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106419496 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 7-methoxy-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | COc1cccc2c1[nH]c(=S)n2Cc1ccno1 |
| InChI | InChI=1S/C12H11N3O2S/c1-16-10-4-2-3-9-11(10)14-12(18)15(9)7-8-5-6-13-17-8/h2-6H,7H2,1H3,(H,14,18) |
| InChIKey | RMXGLZXDWDYDFC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|