About 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione
7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 106405502) has the molecular formula C12H12N4O2S
and a molecular weight of 276.32 g/mol. Its IUPAC name is 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione |
| PubChem CID | 106405502 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | CCOc1cccc2c1[nH]c(=S)n2Cc1ncon1 |
| InChI | InChI=1S/C12H12N4O2S/c1-2-17-9-5-3-4-8-11(9)14-12(19)16(8)6-10-13-7-18-15-10/h3-5,7H,2,6H2,1H3,(H,14,19) |
| InChIKey | SRCYUVWOOUOVRV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione?
The IUPAC name of 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione (CID 106405502) is 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione.
What is the SMILES notation for 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione?
The canonical SMILES for 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione is CCOc1cccc2c1[nH]c(=S)n2Cc1ncon1.
What is the InChIKey of 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione?
The InChIKey is SRCYUVWOOUOVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2S/c1-2-17-9-5-3-4-8-11(9)14-12(19)16(8)6-10-13-7-18-15-10/h3-5,7H,2,6H2,1H3,(H,14,19).
What are the key properties of 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione?
7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione has a molecular weight of 276.32 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione is sourced from PubChem (CID 106405502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).