C12H12N4O2S — CID 106405502
7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 106405502) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106405502 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 7-ethoxy-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | CCOc1cccc2c1[nH]c(=S)n2Cc1ncon1 |
| InChI | InChI=1S/C12H12N4O2S/c1-2-17-9-5-3-4-8-11(9)14-12(19)16(8)6-10-13-7-18-15-10/h3-5,7H,2,6H2,1H3,(H,14,19) |
| InChIKey | SRCYUVWOOUOVRV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|