C10H7ClN4OS — CID 106405472
5-chloro-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 106405472) has the molecular formula C10H7ClN4OS and a molecular weight of 266.71 g/mol. Its IUPAC name is 5-chloro-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-chloro-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106405472 |
| Molecular Formula | C10H7ClN4OS |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 5-chloro-3-(1,2,4-oxadiazol-3-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | S=c1[nH]c2ccc(Cl)cc2n1Cc1ncon1 |
| InChI | InChI=1S/C10H7ClN4OS/c11-6-1-2-7-8(3-6)15(10(17)13-7)4-9-12-5-16-14-9/h1-3,5H,4H2,(H,13,17) |
| InChIKey | VUFSKNARYOEUPU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|