C10H8ClN5OS — CID 114184770
6-chloro-3-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 114184770) has the molecular formula C10H8ClN5OS and a molecular weight of 281.73 g/mol. Its IUPAC name is 6-chloro-3-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-chloro-3-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 114184770 |
| Molecular Formula | C10H8ClN5OS |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 6-chloro-3-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | S=c1[nH]c2cc(Cl)cnc2n1CCc1ncon1 |
| InChI | InChI=1S/C10H8ClN5OS/c11-6-3-7-9(12-4-6)16(10(18)14-7)2-1-8-13-5-17-15-8/h3-5H,1-2H2,(H,14,18) |
| InChIKey | MHTLPGKOAOBVLB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|