C6H8N6OS — CID 106408415
3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 106408415) has the molecular formula C6H8N6OS and a molecular weight of 212.24 g/mol. Its IUPAC name is 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106408415 |
| Molecular Formula | C6H8N6OS |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nc1n[nH]c(=S)n1CCc1ncon1 |
| InChI | InChI=1S/C6H8N6OS/c7-5-9-10-6(14)12(5)2-1-4-8-3-13-11-4/h3H,1-2H2,(H2,7,9)(H,10,14) |
| InChIKey | CKMKBTPQXSOBKB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|