C10H8N4O2S2 — CID 106406619
3-[2-(1,2,4-oxadiazol-3-yl)ethyl]-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 106406619) has the molecular formula C10H8N4O2S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-[2-(1,2,4-oxadiazol-3-yl)ethyl]-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(1,2,4-oxadiazol-3-yl)ethyl]-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 106406619 |
| Molecular Formula | C10H8N4O2S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3-[2-(1,2,4-oxadiazol-3-yl)ethyl]-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2[nH]c(=S)n1CCc1ncon1 |
| InChI | InChI=1S/C10H8N4O2S2/c15-9-6-2-4-18-8(6)12-10(17)14(9)3-1-7-11-5-16-13-7/h2,4-5H,1,3H2,(H,12,17) |
| InChIKey | RQZUGTMFRHPOSD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|