C12H16N2OS2 — CID 60730145
3-hexyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 60730145) has the molecular formula C12H16N2OS2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 3-hexyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-hexyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 60730145 |
| Molecular Formula | C12H16N2OS2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-hexyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCCn1c(=S)[nH]c2sccc2c1=O |
| InChI | InChI=1S/C12H16N2OS2/c1-2-3-4-5-7-14-11(15)9-6-8-17-10(9)13-12(14)16/h6,8H,2-5,7H2,1H3,(H,13,16) |
| InChIKey | GTNFZIQVYUWUSS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|