C10H12N2O2S2 — CID 16767686
3-(3-methoxypropyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 16767686) has the molecular formula C10H12N2O2S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3-methoxypropyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 16767686 |
| Molecular Formula | C10H12N2O2S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 3-(3-methoxypropyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | COCCCn1c(=S)[nH]c2sccc2c1=O |
| InChI | InChI=1S/C10H12N2O2S2/c1-14-5-2-4-12-9(13)7-3-6-16-8(7)11-10(12)15/h3,6H,2,4-5H2,1H3,(H,11,15) |
| InChIKey | FOOWECGMGGQGHP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|