C11H14N2OS2 — CID 145497499
3-butyl-6-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 145497499) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-butyl-6-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-butyl-6-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145497499 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-butyl-6-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCCn1c(=S)[nH]c2sc(C)cc2c1=O |
| InChI | InChI=1S/C11H14N2OS2/c1-3-4-5-13-10(14)8-6-7(2)16-9(8)12-11(13)15/h6H,3-5H2,1-2H3,(H,12,15) |
| InChIKey | ZCQBMHCNSJTSJG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|