C8H8N2S3 — CID 18738536
3,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dithione (PubChem CID 18738536) has the molecular formula C8H8N2S3 and a molecular weight of 228.37 g/mol. Its IUPAC name is 3,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dithione.
| Compound Name | 3,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dithione |
|---|---|
| PubChem CID | 18738536 |
| Molecular Formula | C8H8N2S3 |
| Molecular Weight | 228.37 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 3,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dithione |
| SMILES | Cc1cc2c(=S)n(C)c(=S)[nH]c2s1 |
| InChI | InChI=1S/C8H8N2S3/c1-4-3-5-6(13-4)9-8(12)10(2)7(5)11/h3H,1-2H3,(H,9,12) |
| InChIKey | CCMXALJADKFUDI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|