C10H9NS2 — CID 138667135
4,10-dimethyl-5,9-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene (PubChem CID 138667135) has the molecular formula C10H9NS2 and a molecular weight of 207.32 g/mol. Its IUPAC name is 4,10-dimethyl-5,9-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene.
| Compound Name | 4,10-dimethyl-5,9-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene |
|---|---|
| PubChem CID | 138667135 |
| Molecular Formula | C10H9NS2 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 4,10-dimethyl-5,9-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene |
| SMILES | Cc1cc2c([nH]c3sc(C)cc32)s1 |
| InChI | InChI=1S/C10H9NS2/c1-5-3-7-8-4-6(2)13-10(8)11-9(7)12-5/h3-4,11H,1-2H3 |
| InChIKey | FVWFBOUTQBUIRH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |