C10H15NS — CID 170950785
2,5-dimethyl-6H-thieno[2,3-b]pyrrole;ethane (PubChem CID 170950785) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is 2,5-dimethyl-6H-thieno[2,3-b]pyrrole;ethane.
| Compound Name | 2,5-dimethyl-6H-thieno[2,3-b]pyrrole;ethane |
|---|---|
| PubChem CID | 170950785 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2,5-dimethyl-6H-thieno[2,3-b]pyrrole;ethane |
| SMILES | CC.Cc1cc2cc(C)sc2[nH]1 |
| InChI | InChI=1S/C8H9NS.C2H6/c1-5-3-7-4-6(2)10-8(7)9-5;1-2/h3-4,9H,1-2H3;1-2H3 |
| InChIKey | ZGDIKOGTHZYTGB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |