C15H12ClIN2S2 — CID 143028445
6-chloro-2-methylthieno[2,3-b]pyridine;2-iodo-5-methyl-6H-thieno[2,3-b]pyrrole (PubChem CID 143028445) has the molecular formula C15H12ClIN2S2 and a molecular weight of 446.77 g/mol. Its IUPAC name is 6-chloro-2-methylthieno[2,3-b]pyridine;2-iodo-5-methyl-6H-thieno[2,3-b]pyrrole.
| Compound Name | 6-chloro-2-methylthieno[2,3-b]pyridine;2-iodo-5-methyl-6H-thieno[2,3-b]pyrrole |
|---|---|
| PubChem CID | 143028445 |
| Molecular Formula | C15H12ClIN2S2 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 445.92 |
| IUPAC Name | 6-chloro-2-methylthieno[2,3-b]pyridine;2-iodo-5-methyl-6H-thieno[2,3-b]pyrrole |
| SMILES | Cc1cc2cc(I)sc2[nH]1.Cc1cc2ccc(Cl)nc2s1 |
| InChI | InChI=1S/C8H6ClNS.C7H6INS/c1-5-4-6-2-3-7(9)10-8(6)11-5;1-4-2-5-3-6(8)10-7(5)9-4/h2-4H,1H3;2-3,9H,1H3 |
| InChIKey | AZRBCWCUOUNDQM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|