C11H12ClNS — CID 59102842
2-tert-butyl-5-chlorothieno[3,2-b]pyridine (PubChem CID 59102842) has the molecular formula C11H12ClNS and a molecular weight of 225.74 g/mol. Its IUPAC name is 2-tert-butyl-5-chlorothieno[3,2-b]pyridine.
| Compound Name | 2-tert-butyl-5-chlorothieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 59102842 |
| Molecular Formula | C11H12ClNS |
| Molecular Weight | 225.74 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-tert-butyl-5-chlorothieno[3,2-b]pyridine |
| SMILES | CC(C)(C)c1cc2nc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H12ClNS/c1-11(2,3)9-6-7-8(14-9)4-5-10(12)13-7/h4-6H,1-3H3 |
| InChIKey | DDNDENLWWABCKR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|