C14H7BrCl2N2S2 — CID 158307894
2-bromo-5-chlorothieno[3,2-b]pyridine;5-chlorothieno[3,2-b]pyridine (PubChem CID 158307894) has the molecular formula C14H7BrCl2N2S2 and a molecular weight of 418.17 g/mol. Its IUPAC name is 2-bromo-5-chlorothieno[3,2-b]pyridine;5-chlorothieno[3,2-b]pyridine.
| Compound Name | 2-bromo-5-chlorothieno[3,2-b]pyridine;5-chlorothieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 158307894 |
| Molecular Formula | C14H7BrCl2N2S2 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 415.86 |
| IUPAC Name | 2-bromo-5-chlorothieno[3,2-b]pyridine;5-chlorothieno[3,2-b]pyridine |
| SMILES | Clc1ccc2sc(Br)cc2n1.Clc1ccc2sccc2n1 |
| InChI | InChI=1S/C7H3BrClNS.C7H4ClNS/c8-6-3-4-5(11-6)1-2-7(9)10-4;8-7-2-1-6-5(9-7)3-4-10-6/h1-3H;1-4H |
| InChIKey | GNHUGPAMLSUGSE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|