C15H13ClN2S — CID 43185912
2-(5-chloro-1,3-benzothiazol-2-yl)-1-phenylethanamine (PubChem CID 43185912) has the molecular formula C15H13ClN2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 2-(5-chloro-1,3-benzothiazol-2-yl)-1-phenylethanamine.
| Compound Name | 2-(5-chloro-1,3-benzothiazol-2-yl)-1-phenylethanamine |
|---|---|
| PubChem CID | 43185912 |
| Molecular Formula | C15H13ClN2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-(5-chloro-1,3-benzothiazol-2-yl)-1-phenylethanamine |
| SMILES | NC(Cc1nc2cc(Cl)ccc2s1)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2S/c16-11-6-7-14-13(8-11)18-15(19-14)9-12(17)10-4-2-1-3-5-10/h1-8,12H,9,17H2 |
| InChIKey | SJPYRPYVFUEWDO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |