C15H11F3N2S — CID 79754913
2-(1,3-benzothiazol-2-yl)-1-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 79754913) has the molecular formula C15H11F3N2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 79754913 |
| Molecular Formula | C15H11F3N2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | NC(Cc1nc2ccccc2s1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H11F3N2S/c16-9-6-5-8(14(17)15(9)18)10(19)7-13-20-11-3-1-2-4-12(11)21-13/h1-6,10H,7,19H2 |
| InChIKey | LNKRFSSVNJCXIB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|