C15H12BrFN2S — CID 82809666
2-(1,3-benzothiazol-2-yl)-1-(3-bromo-4-fluorophenyl)ethanamine (PubChem CID 82809666) has the molecular formula C15H12BrFN2S and a molecular weight of 351.24 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(3-bromo-4-fluorophenyl)ethanamine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(3-bromo-4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 82809666 |
| Molecular Formula | C15H12BrFN2S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(3-bromo-4-fluorophenyl)ethanamine |
| SMILES | NC(Cc1nc2ccccc2s1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H12BrFN2S/c16-10-7-9(5-6-11(10)17)12(18)8-15-19-13-3-1-2-4-14(13)20-15/h1-7,12H,8,18H2 |
| InChIKey | UIVMFDSYUYRCBF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |