C15H11BrFNOS — CID 66460480
2-(1,3-benzothiazol-2-yl)-1-(4-bromo-3-fluorophenyl)ethanol (PubChem CID 66460480) has the molecular formula C15H11BrFNOS and a molecular weight of 352.23 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(4-bromo-3-fluorophenyl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(4-bromo-3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 66460480 |
| Molecular Formula | C15H11BrFNOS |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(4-bromo-3-fluorophenyl)ethanol |
| SMILES | OC(Cc1nc2ccccc2s1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C15H11BrFNOS/c16-10-6-5-9(7-11(10)17)13(19)8-15-18-12-3-1-2-4-14(12)20-15/h1-7,13,19H,8H2 |
| InChIKey | NSAXIDDFHKNPBQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |