C18H17NOS — CID 79973010
2-(1,3-benzothiazol-2-yl)-1-(3-cyclopropylphenyl)ethanol (PubChem CID 79973010) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(3-cyclopropylphenyl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(3-cyclopropylphenyl)ethanol |
|---|---|
| PubChem CID | 79973010 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(3-cyclopropylphenyl)ethanol |
| SMILES | OC(Cc1nc2ccccc2s1)c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C18H17NOS/c20-16(14-5-3-4-13(10-14)12-8-9-12)11-18-19-15-6-1-2-7-17(15)21-18/h1-7,10,12,16,20H,8-9,11H2 |
| InChIKey | AELGABONJVWZHX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |