C15H9BrF3NS — CID 79755788
2-[2-bromo-2-(2,3,4-trifluorophenyl)ethyl]-1,3-benzothiazole (PubChem CID 79755788) has the molecular formula C15H9BrF3NS and a molecular weight of 372.21 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,3,4-trifluorophenyl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-bromo-2-(2,3,4-trifluorophenyl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 79755788 |
| Molecular Formula | C15H9BrF3NS |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 2-[2-bromo-2-(2,3,4-trifluorophenyl)ethyl]-1,3-benzothiazole |
| SMILES | Fc1ccc(C(Br)Cc2nc3ccccc3s2)c(F)c1F |
| InChI | InChI=1S/C15H9BrF3NS/c16-9(8-5-6-10(17)15(19)14(8)18)7-13-20-11-3-1-2-4-12(11)21-13/h1-6,9H,7H2 |
| InChIKey | SIUSNASHQXGFJO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|