C16H13Br2NOS — CID 115370364
2-[2-bromo-2-(4-bromo-2-methoxyphenyl)ethyl]-1,3-benzothiazole (PubChem CID 115370364) has the molecular formula C16H13Br2NOS and a molecular weight of 427.16 g/mol. Its IUPAC name is 2-[2-bromo-2-(4-bromo-2-methoxyphenyl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-bromo-2-(4-bromo-2-methoxyphenyl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 115370364 |
| Molecular Formula | C16H13Br2NOS |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.91 |
| IUPAC Name | 2-[2-bromo-2-(4-bromo-2-methoxyphenyl)ethyl]-1,3-benzothiazole |
| SMILES | COc1cc(Br)ccc1C(Br)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H13Br2NOS/c1-20-14-8-10(17)6-7-11(14)12(18)9-16-19-13-4-2-3-5-15(13)21-16/h2-8,12H,9H2,1H3 |
| InChIKey | WUASMGKKVLNGSA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|