C17H16BrNOS — CID 66460052
2-[2-bromo-2-(4-ethoxyphenyl)ethyl]-1,3-benzothiazole (PubChem CID 66460052) has the molecular formula C17H16BrNOS and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-[2-bromo-2-(4-ethoxyphenyl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-bromo-2-(4-ethoxyphenyl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 66460052 |
| Molecular Formula | C17H16BrNOS |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-[2-bromo-2-(4-ethoxyphenyl)ethyl]-1,3-benzothiazole |
| SMILES | CCOc1ccc(C(Br)Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H16BrNOS/c1-2-20-13-9-7-12(8-10-13)14(18)11-17-19-15-5-3-4-6-16(15)21-17/h3-10,14H,2,11H2,1H3 |
| InChIKey | ICTYBXOWWVWLLE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|