C19H20N2O2S2 — CID 51207979
N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(4-ethoxyphenyl)sulfanylacetamide (PubChem CID 51207979) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(4-ethoxyphenyl)sulfanylacetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(4-ethoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 51207979 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(4-ethoxyphenyl)sulfanylacetamide |
| SMILES | CCOc1ccc(SCC(=O)NCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H20N2O2S2/c1-2-23-14-7-9-15(10-8-14)24-13-18(22)20-12-11-19-21-16-5-3-4-6-17(16)25-19/h3-10H,2,11-13H2,1H3,(H,20,22) |
| InChIKey | YOWADAKJWQBYSV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |