C16H13BrClNS — CID 66460951
2-[2-(5-bromo-2-methylphenyl)-2-chloroethyl]-1,3-benzothiazole (PubChem CID 66460951) has the molecular formula C16H13BrClNS and a molecular weight of 366.71 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-methylphenyl)-2-chloroethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(5-bromo-2-methylphenyl)-2-chloroethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 66460951 |
| Molecular Formula | C16H13BrClNS |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 2-[2-(5-bromo-2-methylphenyl)-2-chloroethyl]-1,3-benzothiazole |
| SMILES | Cc1ccc(Br)cc1C(Cl)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H13BrClNS/c1-10-6-7-11(17)8-12(10)13(18)9-16-19-14-4-2-3-5-15(14)20-16/h2-8,13H,9H2,1H3 |
| InChIKey | BHZSRHMXBZKLBF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|