C17H19N3S — CID 105325082
[2-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylphenyl)ethyl]hydrazine (PubChem CID 105325082) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylphenyl)ethyl]hydrazine.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105325082 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylphenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(C)c(C(Cc2nc3ccccc3s2)NN)c1 |
| InChI | InChI=1S/C17H19N3S/c1-11-7-8-12(2)13(9-11)15(20-18)10-17-19-14-5-3-4-6-16(14)21-17/h3-9,15,20H,10,18H2,1-2H3 |
| InChIKey | USBIQMPSESUVDE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|