C13H12ClN3OS — CID 106694613
[2-(1,3-benzothiazol-2-yl)-1-(5-chlorofuran-2-yl)ethyl]hydrazine (PubChem CID 106694613) has the molecular formula C13H12ClN3OS and a molecular weight of 293.78 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-1-(5-chlorofuran-2-yl)ethyl]hydrazine.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-1-(5-chlorofuran-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106694613 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-1-(5-chlorofuran-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1nc2ccccc2s1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C13H12ClN3OS/c14-12-6-5-10(18-12)9(17-15)7-13-16-8-3-1-2-4-11(8)19-13/h1-6,9,17H,7,15H2 |
| InChIKey | ZRODYAJSDHGRRL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|