C16H16ClN3S — CID 105325041
[2-(1,3-benzothiazol-2-yl)-1-(3-chloro-5-methylphenyl)ethyl]hydrazine (PubChem CID 105325041) has the molecular formula C16H16ClN3S and a molecular weight of 317.85 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-1-(3-chloro-5-methylphenyl)ethyl]hydrazine.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-1-(3-chloro-5-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105325041 |
| Molecular Formula | C16H16ClN3S |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-1-(3-chloro-5-methylphenyl)ethyl]hydrazine |
| SMILES | Cc1cc(Cl)cc(C(Cc2nc3ccccc3s2)NN)c1 |
| InChI | InChI=1S/C16H16ClN3S/c1-10-6-11(8-12(17)7-10)14(20-18)9-16-19-13-4-2-3-5-15(13)21-16/h2-8,14,20H,9,18H2,1H3 |
| InChIKey | MYELSLFRGAUUKN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|