C10H9ClN2O2S — CID 18427339
3-amino-3-(5-chloro-1,3-benzothiazol-2-yl)propanoic acid (PubChem CID 18427339) has the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. Its IUPAC name is 3-amino-3-(5-chloro-1,3-benzothiazol-2-yl)propanoic acid.
| Compound Name | 3-amino-3-(5-chloro-1,3-benzothiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 18427339 |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 3-amino-3-(5-chloro-1,3-benzothiazol-2-yl)propanoic acid |
| SMILES | NC(CC(=O)O)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C10H9ClN2O2S/c11-5-1-2-8-7(3-5)13-10(16-8)6(12)4-9(14)15/h1-3,6H,4,12H2,(H,14,15) |
| InChIKey | XFFFRNBHYNNGNK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |