C12H14ClNS — CID 91375937
5-chloro-2-pentan-2-yl-1,3-benzothiazole (PubChem CID 91375937) has the molecular formula C12H14ClNS and a molecular weight of 239.77 g/mol. Its IUPAC name is 5-chloro-2-pentan-2-yl-1,3-benzothiazole.
| Compound Name | 5-chloro-2-pentan-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 91375937 |
| Molecular Formula | C12H14ClNS |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-chloro-2-pentan-2-yl-1,3-benzothiazole |
| SMILES | CCCC(C)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C12H14ClNS/c1-3-4-8(2)12-14-10-7-9(13)5-6-11(10)15-12/h5-8H,3-4H2,1-2H3 |
| InChIKey | JEAJSGGXNCDFSM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |