C11H12ClNS — CID 58291254
2-butan-2-yl-5-chloro-1,3-benzothiazole (PubChem CID 58291254) has the molecular formula C11H12ClNS and a molecular weight of 225.74 g/mol. Its IUPAC name is 2-butan-2-yl-5-chloro-1,3-benzothiazole.
| Compound Name | 2-butan-2-yl-5-chloro-1,3-benzothiazole |
|---|---|
| PubChem CID | 58291254 |
| Molecular Formula | C11H12ClNS |
| Molecular Weight | 225.74 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-butan-2-yl-5-chloro-1,3-benzothiazole |
| SMILES | CCC(C)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H12ClNS/c1-3-7(2)11-13-9-6-8(12)4-5-10(9)14-11/h4-7H,3H2,1-2H3 |
| InChIKey | JROXTYAFHGOATC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.74 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |