C12H15ClN2S — CID 104685724
4-(5-chloro-1,3-benzothiazol-2-yl)pentan-1-amine (PubChem CID 104685724) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is 4-(5-chloro-1,3-benzothiazol-2-yl)pentan-1-amine.
| Compound Name | 4-(5-chloro-1,3-benzothiazol-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 104685724 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4-(5-chloro-1,3-benzothiazol-2-yl)pentan-1-amine |
| SMILES | CC(CCCN)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C12H15ClN2S/c1-8(3-2-6-14)12-15-10-7-9(13)4-5-11(10)16-12/h4-5,7-8H,2-3,6,14H2,1H3 |
| InChIKey | MBIKOAMBUGVJIZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |