C11H10ClNO2S — CID 119086695
3-(6-chloro-1,3-benzothiazol-2-yl)butanoic acid (PubChem CID 119086695) has the molecular formula C11H10ClNO2S and a molecular weight of 255.73 g/mol. Its IUPAC name is 3-(6-chloro-1,3-benzothiazol-2-yl)butanoic acid.
| Compound Name | 3-(6-chloro-1,3-benzothiazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 119086695 |
| Molecular Formula | C11H10ClNO2S |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 3-(6-chloro-1,3-benzothiazol-2-yl)butanoic acid |
| SMILES | CC(CC(=O)O)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C11H10ClNO2S/c1-6(4-10(14)15)11-13-8-3-2-7(12)5-9(8)16-11/h2-3,5-6H,4H2,1H3,(H,14,15) |
| InChIKey | BBUYZIHBBGMAHX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |