C21H23ClN2O2S — CID 123927021
2-[3-(6-chloro-1,3-benzothiazol-2-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carbaldehyde (PubChem CID 123927021) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-[3-(6-chloro-1,3-benzothiazol-2-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carbaldehyde.
| Compound Name | 2-[3-(6-chloro-1,3-benzothiazol-2-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carbaldehyde |
|---|---|
| PubChem CID | 123927021 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[3-(6-chloro-1,3-benzothiazol-2-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-5-carbaldehyde |
| SMILES | CC(CC(=O)N1C2CC3CC1CC(C=O)(C3)C2)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C21H23ClN2O2S/c1-12(20-23-17-3-2-14(22)7-18(17)27-20)4-19(26)24-15-5-13-6-16(24)10-21(8-13,9-15)11-25/h2-3,7,11-13,15-16H,4-6,8-10H2,1H3 |
| InChIKey | SFJNODZOEZBYDP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|